On Target NA_A-H3N8 0.34051725/CHEMBL4285767
For the given ligand MM173, we have found in our database that, being scored 0.34051725, the most similar ligand is CHEMBL4285767. Check out the elaboration below.
| MM173 (Given Ligand) | CHEMBL4285767 (Similar Ligand) |
|---|---|
| CC(C)(C)/C3=C/2CC(=O)/C(c1ccccc1)=C2/[C@H]4[C@H](CC3)/C(=C\CO)C(=O)N4c5cncnc5 | CCc1ccc(CN[C@H]2CC(C(=O)O)=C[C@@H](OC(CC)CC)[C@@H]2NC(C)=O)cc1 |
|
|
|
|
|
|
| 00030212 09049000 02990302 00010620 60010000 00006011 801800c0 38000402 01000940 405888c8 08380004 41419008 0502811a 20210000 40000403 000c010c 20000400 02000140 40492090 82800201 00100110 18040790 20808060 0050001a 01201082 8830ac00 00486600 d00101a0 00420002 88460403 6c022000 03802680 | 00070040 09007000 00100100 84010700 00180080 00000800 02080180 3a00140a 11000100 001908c8 48200000 41019801 8402881a 01882000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000020 38048e80 13008080 02500018 10001401 c0001400 00c04000 90000001 0c000300 00060403 24060000 00800e10 |