On Target NA_A-H3N8 0.33333334/CHEMBL674
For the given ligand MM167, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL674. Check out the elaboration below.
| MM167 (Given Ligand) | CHEMBL674 (Similar Ligand) |
|---|---|
| C=C3C(=O)N(c1cccs1)[C@H]4c2cc(C)cc2=C(C)CC[C@@H]34 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00034202 09001000 02100000 00000602 20000000 00002410 00088100 30200412 01000000 0010008a 00280204 61011481 0c02800a 00110000 00020400 00100000 00040000 00000150 48012000 00000201 00100000 58040690 6000a000 00100018 00200080 04010000 00484200 90000484 00000010 010e0401 24020000 02c12200 | 00070040 09007000 00100000 80010500 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a04000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04000 90000001 0c000200 00040401 04020000 00000210 |