On Target NSP15_SARS 0.23655914/CHEMBL2441741
For the given ligand MM174, we have found in our database that, being scored 0.23655914, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| MM174 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| C=C3C(=O)N(c1cn(C)cn1)[C@H]4c2c(CO)c(C)cc2=C(C(C)C)CC[C@H]34 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00030202 89001000 02110000 00000421 20180040 00002010 00080000 20100c02 01000100 40100088 00388008 41011000 0402900a 00a10000 00000401 000c000c 00000000 00004140 40412000 80202201 80100000 18040610 2100c000 00100018 40200082 00108000 00484610 90000080 00020008 01460401 64021000 02802b00 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |