On Target PLP_SARS 0.3888889/CHEMBL213543
For the given ligand MM173, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| MM173 (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| CC(C)(C)/C3=C/2CC(=O)/C(c1ccccc1)=C2/[C@H]4[C@H](CC3)/C(=C\CO)C(=O)N4c5cncnc5 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 00030212 09049000 02990302 00010620 60010000 00006011 801800c0 38000402 01000940 405888c8 08380004 41419008 0502811a 20210000 40000403 000c010c 20000400 02000140 40492090 82800201 00100110 18040790 20808060 0050001a 01201082 8830ac00 00486600 d00101a0 00420002 88460403 6c022000 03802680 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |