On Target PLP_SARS 0.33476394/CHEMBL213543
For the given ligand MM166, we have found in our database that, being scored 0.33476394, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| MM166 (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| C=C4C(=O)N(c1cccs1)[C@H]5/C3=C(c2ccccc2)/C(=O)C[C@@]3(O)[C@H](O)CC[C@@H]45 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 00074212 89009000 02100b02 00010602 20190000 00002410 80188380 30200412 01000800 005888ca 08380204 60419489 1d02811a 01b10000 40020406 00580108 20040400 02000110 48c12018 02802201 00100100 58140790 6500a0a0 00500018 01201001 8c210400 00486000 d00115a4 00400012 800e0003 2c022000 02c12e00 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |