On Target E1_HCV77 0.2923077/CHEMBL3894536
For the given ligand MM166, we have found in our database that, being scored 0.2923077, the most similar ligand is CHEMBL3894536. Check out the elaboration below.
| MM166 (Given Ligand) | CHEMBL3894536 (Similar Ligand) |
|---|---|
| C=C4C(=O)N(c1cccs1)[C@H]5/C3=C(c2ccccc2)/C(=O)C[C@@]3(O)[C@H](O)CC[C@@H]45 | CC[C@H](NC(=O)C1=CCCNC1)c1ccc(Cl)c(C(=O)c2cccnc2)c1F |
|
|
|
|
|
|
| 00074212 89009000 02100b02 00010602 20190000 00002410 80188380 30200412 01000800 005888ca 08380204 60419489 1d02811a 01b10000 40020406 00580108 20040400 02000110 48c12018 02802201 00100100 58140790 6500a0a0 00500018 01201001 8c210400 00486000 d00115a4 00400012 800e0003 2c022000 02c12e00 | 080080d2 0880dc00 00104100 02010610 00041201 00000010 30182100 03001400 01400800 00180f60 08300004 40009a00 0a008966 00011004 00000400 080c020c 23010200 03000144 00210412 00000201 c0000500 18068780 21808000 3040001c 00043000 e0000200 084c0200 c0800181 00400180 01068413 a4040000 02022600 |