On Target NSP1_SARS 0.29545453/CHEMBL2441741
For the given ligand MM173, we have found in our database that, being scored 0.29545453, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| MM173 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| CC(C)(C)/C3=C/2CC(=O)/C(c1ccccc1)=C2/[C@H]4[C@H](CC3)/C(=C\CO)C(=O)N4c5cncnc5 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00030212 09049000 02990302 00010620 60010000 00006011 801800c0 38000402 01000940 405888c8 08380004 41419008 0502811a 20210000 40000403 000c010c 20000400 02000140 40492090 82800201 00100110 18040790 20808060 0050001a 01201082 8830ac00 00486600 d00101a0 00420002 88460403 6c022000 03802680 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |