On Target NSP1_SARS 0.22651933/CHEMBL2441741
For the given ligand MM167, we have found in our database that, being scored 0.22651933, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| MM167 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| C=C3C(=O)N(c1cccs1)[C@H]4c2cc(C)cc2=C(C)CC[C@@H]34 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00034202 09001000 02100000 00000602 20000000 00002410 00088100 30200412 01000000 0010008a 00280204 61011481 0c02800a 00110000 00020400 00100000 00040000 00000150 48012000 00000201 00100000 58040690 6000a000 00100018 00200080 04010000 00484200 90000484 00000010 010e0401 24020000 02c12200 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |