On Target PA_INFA 0.30708662/CHEMBL2040554
For the given ligand CHEMBL415, we have found in our database that, being scored 0.30708662, the most similar ligand is CHEMBL2040554. Check out the elaboration below.
| CHEMBL415 (Given Ligand) | CHEMBL2040554 (Similar Ligand) |
|---|---|
| CN(C)CCCN3c1ccccc1CCc2ccc(Cl)cc23 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(CC2CCCCC2)CC1 |
|
|
|
|
|
|
| 0000c002 00000000 00100100 01010600 20000000 00000040 08000010 00000040 00002800 00480960 08300004 40008800 02000024 00000001 00020040 00000002 0004c000 02000000 0800000a 00004001 60100100 18100900 20000000 00400010 00002800 80000000 02040008 00001080 00088000 00260012 00000080 20020700 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 28000400 01100800 001808c0 08300000 5001d800 86028026 00200000 00000400 00080008 00000000 02000000 02252018 00000201 00000100 18000b90 04008000 00500010 00003800 80002400 00444000 90000000 00004000 00060002 04020000 00822600 |