On Target PR_HIV1 0.20430107/CHEMBL510485
For the given ligand CHEMBL415, we have found in our database that, being scored 0.20430107, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| CHEMBL415 (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| CN(C)CCCN3c1ccccc1CCc2ccc(Cl)cc23 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 0000c002 00000000 00100100 01010600 20000000 00000040 08000010 00000040 00002800 00480960 08300004 40008800 02000024 00000001 00020040 00000002 0004c000 02000000 0800000a 00004001 60100100 18100900 20000000 00400010 00002800 80000000 02040008 00001080 00088000 00260012 00000080 20020700 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |