On Target NS5B_HCV1A 0.24186046/CHEMBL3644912
For the given ligand CHEMBL415, we have found in our database that, being scored 0.24186046, the most similar ligand is CHEMBL3644912. Check out the elaboration below.
| CHEMBL415 (Given Ligand) | CHEMBL3644912 (Similar Ligand) |
|---|---|
| CN(C)CCCN3c1ccccc1CCc2ccc(Cl)cc23 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(C3CCCCC3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 0000c002 00000000 00100100 01010600 20000000 00000040 08000010 00000040 00002800 00480960 08300004 40008800 02000024 00000001 00020040 00000002 0004c000 02000000 0800000a 00004001 60100100 18100900 20000000 00400010 00002800 80000000 02040008 00001080 00088000 00260012 00000080 20020700 | 00014086 0d403c00 00100122 45310f00 20080000 00018000 000a0004 a0003409 10800a00 005a8be8 08302404 5001b000 0e00f002 0124a101 80420440 001a8008 02864010 02482000 4a612850 00004a01 60100100 bc050e10 21020003 3244003a 02112000 80001002 00000000 902000ac 08008202 81060093 a41a4000 01016670 |