On Target PLP_SARS 0.2986111/CHEMBL358279
For the given ligand CHEMBL415, we have found in our database that, being scored 0.2986111, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| CHEMBL415 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| CN(C)CCCN3c1ccccc1CCc2ccc(Cl)cc23 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 0000c002 00000000 00100100 01010600 20000000 00000040 08000010 00000040 00002800 00480960 08300004 40008800 02000024 00000001 00020040 00000002 0004c000 02000000 0800000a 00004001 60100100 18100900 20000000 00400010 00002800 80000000 02040008 00001080 00088000 00260012 00000080 20020700 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |