On Target NS3_HCV1B 0.30857143/CHEMBL297884
For the given ligand minocycline, we have found in our database that, being scored 0.30857143, the most similar ligand is CHEMBL297884. Check out the elaboration below.
| minocycline (Given Ligand) | CHEMBL297884 (Similar Ligand) |
|---|---|
| [H][C@@]24Cc1c(N(C)C)ccc(O)c1/C(O)=C2/C(=O)[C@]3(O)/C(O)=C(C(N)=O)\C(=O)[C@@H](N(C)C)[C@]3([H])C4 | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCC[C@H](NC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3csc(NC(C)C)n3)nc2c1 |
|
|
|
|
|
|
| 100f0012 cb000008 21900312 00310600 22390004 40006001 830800c0 18000c02 11a00940 005a88da 08302204 4143f800 9c02802a 00b00000 00020466 0008210a 2004c400 02000160 1ac5a01c 80022203 40100500 580006b0 2500c0a0 00500010 01241000 80000e01 00446000 d0001180 0442c002 00060402 7c024080 20c10e02 | 04072002 c9427008 a0104908 14810702 211c10a0 02118050 c6080100 b00a848a 10800300 2010c8ca 00202a04 5101b420 0e82881a 01502183 911a3441 021e200c 10a24000 120861c4 44e82818 12e63a01 40080000 3914aef8 f390c883 82510018 00a01081 8c101002 00e04240 90200465 0c00420c 850e2403 e4065800 04252a42 |