On Target PA_INFA 0.3590909/CHEMBL278402
For the given ligand minocycline, we have found in our database that, being scored 0.3590909, the most similar ligand is CHEMBL278402. Check out the elaboration below.
| minocycline (Given Ligand) | CHEMBL278402 (Similar Ligand) |
|---|---|
| [H][C@@]24Cc1c(N(C)C)ccc(O)c1/C(O)=C2/C(=O)[C@]3(O)/C(O)=C(C(N)=O)\C(=O)[C@@H](N(C)C)[C@]3([H])C4 | O=C(O)C(=O)/C=C(\O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 100f0012 cb000008 21900312 00310600 22390004 40006001 830800c0 18000c02 11a00940 005a88da 08302204 4143f800 9c02802a 00b00000 00020466 0008210a 2004c400 02000160 1ac5a01c 80022203 40100500 580006b0 2500c0a0 00500010 01241000 80000e01 00446000 d0001180 0442c002 00060402 7c024080 20c10e02 | 00008000 01000000 00900902 00110600 00100000 00000000 000001c0 22001402 15100840 001808c2 08300200 5001d800 82028826 00200000 00000404 00080008 00004000 02000000 00450000 00000201 00000100 18008b80 01008040 00500010 00202000 c0000000 00440000 90000000 04004100 00060002 34040000 00030e00 |