On Target NS5B_HCV2A 0.27888447/CHEMBL3127326
For the given ligand minocycline, we have found in our database that, being scored 0.27888447, the most similar ligand is CHEMBL3127326. Check out the elaboration below.
| minocycline (Given Ligand) | CHEMBL3127326 (Similar Ligand) |
|---|---|
| [H][C@@]24Cc1c(N(C)C)ccc(O)c1/C(O)=C2/C(=O)[C@]3(O)/C(O)=C(C(N)=O)\C(=O)[C@@H](N(C)C)[C@]3([H])C4 | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc(C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 100f0012 cb000008 21900312 00310600 22390004 40006001 830800c0 18000c02 11a00940 005a88da 08302204 4143f800 9c02802a 00b00000 00020466 0008210a 2004c400 02000160 1ac5a01c 80022203 40100500 580006b0 2500c0a0 00500010 01241000 80000e01 00446000 d0001180 0442c002 00060402 7c024080 20c10e02 | 00014002 01003800 00100122 c4010600 20000000 0001a010 00000000 22001008 00900a00 00080ac0 08380004 4001f000 0e008812 0030a001 80020440 00120008 00062000 02080000 08002010 00000201 40100100 38048e30 20012003 0250001a 00000000 c0000002 00000000 900000a0 08008302 00060003 a0044000 00002600 |