On Target NS5B_HCV1A 0.28903654/CHEMBL3644934
For the given ligand minocycline, we have found in our database that, being scored 0.28903654, the most similar ligand is CHEMBL3644934. Check out the elaboration below.
| minocycline (Given Ligand) | CHEMBL3644934 (Similar Ligand) |
|---|---|
| [H][C@@]24Cc1c(N(C)C)ccc(O)c1/C(O)=C2/C(=O)[C@]3(O)/C(O)=C(C(N)=O)\C(=O)[C@@H](N(C)C)[C@]3([H])C4 | CC(C)(C)OC(=O)N[C@H]1CCCCC/C=C\[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]2CN(c3ccc(-c4ccccc4)cc3)CN2C1=O |
|
|
|
|
|
|
| 100f0012 cb000008 21900312 00310600 22390004 40006001 830800c0 18000c02 11a00940 005a88da 08302204 4143f800 9c02802a 00b00000 00020466 0008210a 2004c400 02000160 1ac5a01c 80022203 40100500 580006b0 2500c0a0 00500010 01241000 80000e01 00446000 d0001180 0442c002 00060402 7c024080 20c10e02 | 00016086 0d403c00 00100120 05310e00 20000000 00018000 000a0004 2000340b 10800200 00528be8 00202404 5101b000 0e02f00a 0104a001 80420440 001a8008 02064010 02482040 4c212850 02004a01 60100100 bc070e50 30028003 3254003a 02312000 80000002 00404000 902000ec 0c00c200 80060491 a41a4000 01016270 |