On Target ACE2_HUMAN 0.1908397/CHEMBL271224
For the given ligand Comp2, we have found in our database that, being scored 0.1908397, the most similar ligand is CHEMBL271224. Check out the elaboration below.
| Comp2 (Given Ligand) | CHEMBL271224 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1C#CC2CCCCC2 | O=C(N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O)[C@@H](S)CC1CCCCC1 |
|
|
|
|
|
|
| 00000200 810a0800 00000900 00090200 00402000 0000c000 00200200 00000000 00000100 00000840 00000080 40008808 00008000 00201000 01000000 40080008 00000200 02000000 02002002 00000001 00000008 08820a20 00000801 02400015 00000004 80010000 00000000 00000000 00000000 00020200 c0020800 00000000 | 00012000 01005000 00100100 00110600 00000080 00000000 80000000 20000004 00200980 020a08c0 08300000 4003b800 0600800a 00040000 80080000 00080008 10020000 02000000 06402008 10000201 00000100 18200e10 13000140 85500018 00000800 80000000 00000000 10000040 04004000 00060003 20024000 03012600 |