On Target ACE2_HUMAN 0.20710059/CHEMBL251808
For the given ligand Comp3, we have found in our database that, being scored 0.20710059, the most similar ligand is CHEMBL251808. Check out the elaboration below.
| Comp3 (Given Ligand) | CHEMBL251808 (Similar Ligand) |
|---|---|
| O=C(O)c1cc(F)ccc1C#C/C\2=C/C/C=C2 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(OCc2ccc(F)c(F)c2)cc1)C(=O)O |
|
|
|
|
|
|
| 08000200 800e0800 00100900 02090200 00402000 0000c011 00000200 00000502 00000100 00102840 01000000 d4008808 80008800 00201000 01000200 40080008 00000000 22008000 00000002 20100000 02001001 08820a20 0000a001 82400815 00000004 80010002 00400000 02c00001 00000002 00028000 c4000800 00000200 | 04010000 01405008 20100108 02110600 00001080 00004010 82040000 20000004 00000980 020a28c0 08300000 5001b000 06808002 00051000 81080001 02080008 10001000 02000200 00400008 00120201 00000100 18200e20 03000140 85d01018 00000800 80002002 00120000 10000041 04000200 00068003 60004000 03012600 |