On Target PA_INFA 0.24489796/CHEMBL1829211
For the given ligand Comp2, we have found in our database that, being scored 0.24489796, the most similar ligand is CHEMBL1829211. Check out the elaboration below.
| Comp2 (Given Ligand) | CHEMBL1829211 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1C#CC2CCCCC2 | O=C(O)/C(O)=C/C(=O)c1ccc(-c2ccccc2)cc1 |
|
|
|
|
|
|
| 00000200 810a0800 00000900 00090200 00402000 0000c000 00200200 00000000 00000100 00000840 00000080 40008808 00008000 00201000 01000000 40080008 00000200 02000000 02002002 00000001 00000008 08820a20 00000801 02400015 00000004 80010000 00000000 00000000 00000000 00020200 c0020800 00000000 | 00002000 00000800 00000100 40010200 00000000 00800000 00000001 00000400 01000100 00980840 08000000 4000c800 80008000 00000000 00000000 00080008 00020400 02100000 04250010 10000800 00000000 18020a80 14008000 00400014 00001000 84004400 00400000 00000040 00004000 00020002 84000000 00000400 |