On Target GP_EBOV 0.1969697/CHEMBL4640931
For the given ligand Comp2, we have found in our database that, being scored 0.1969697, the most similar ligand is CHEMBL4640931. Check out the elaboration below.
| Comp2 (Given Ligand) | CHEMBL4640931 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1C#CC2CCCCC2 | CC(c1ccc(C(=O)N2CCc3cc(C(C)(C)C)ccc32)cc1)N1CCCCC1 |
|
|
|
|
|
|
| 00000200 810a0800 00000900 00090200 00402000 0000c000 00200200 00000000 00000100 00000840 00000080 40008808 00008000 00201000 01000000 40080008 00000200 02000000 02002002 00000001 00000008 08820a20 00000801 02400015 00000004 80010000 00000000 00000000 00000000 00020200 c0020800 00000000 | 00004002 01001800 00100100 40010600 20001001 00000040 00000000 22001004 00000180 000808c0 08280024 5001c800 80008802 00108000 00020540 00080008 00048000 02000000 08000000 00000201 40100000 18228600 20012000 8154001d 00000000 c0000000 00000010 90801080 04088100 00060003 a0040000 20000600 |