On Target GP_EBOV 0.20779221/CHEMBL4640931
For the given ligand Comp3, we have found in our database that, being scored 0.20779221, the most similar ligand is CHEMBL4640931. Check out the elaboration below.
| Comp3 (Given Ligand) | CHEMBL4640931 (Similar Ligand) |
|---|---|
| O=C(O)c1cc(F)ccc1C#C/C\2=C/C/C=C2 | CC(c1ccc(C(=O)N2CCc3cc(C(C)(C)C)ccc32)cc1)N1CCCCC1 |
|
|
|
|
|
|
| 08000200 800e0800 00100900 02090200 00402000 0000c011 00000200 00000502 00000100 00102840 01000000 d4008808 80008800 00201000 01000200 40080008 00000000 22008000 00000002 20100000 02001001 08820a20 0000a001 82400815 00000004 80010002 00400000 02c00001 00000002 00028000 c4000800 00000200 | 00004002 01001800 00100100 40010600 20001001 00000040 00000000 22001004 00000180 000808c0 08280024 5001c800 80008802 00108000 00020540 00080008 00048000 02000000 08000000 00000201 40100000 18228600 20012000 8154001d 00000000 c0000000 00000010 90801080 04088100 00060003 a0040000 20000600 |