On Target PR_HIV1 0.14124294/CHEMBL492666
For the given ligand Comp2, we have found in our database that, being scored 0.14124294, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Comp2 (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1C#CC2CCCCC2 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00000200 810a0800 00000900 00090200 00402000 0000c000 00200200 00000000 00000100 00000840 00000080 40008808 00008000 00201000 01000000 40080008 00000200 02000000 02002002 00000001 00000008 08820a20 00000801 02400015 00000004 80010000 00000000 00000000 00000000 00020200 c0020800 00000000 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |