On Target NS5B_HCV1A 0.22881356/CHEMBL367415
For the given ligand Comp2, we have found in our database that, being scored 0.22881356, the most similar ligand is CHEMBL367415. Check out the elaboration below.
| Comp2 (Given Ligand) | CHEMBL367415 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1C#CC2CCCCC2 | N#Cc1c(Cl)cccc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00000200 810a0800 00000900 00090200 00402000 0000c000 00200200 00000000 00000100 00000840 00000080 40008808 00008000 00201000 01000000 40080008 00000200 02000000 02002002 00000001 00000008 08820a20 00000801 02400015 00000004 80010000 00000000 00000000 00000000 00020200 c0020800 00000000 | 0005a000 01000801 00000102 00810200 00080021 00000000 04000000 00000000 04100900 00880840 08100000 4001d800 06008004 00200008 a0000000 08082008 00420000 02001000 04c00008 00002001 00000100 08020b00 11000480 00400014 00002800 80000280 00000000 00000041 10004002 00020402 80000000 00420400 |