On Target NS5B_HCV1B 0.16746412/CHEMBL3645179
For the given ligand Comp2, we have found in our database that, being scored 0.16746412, the most similar ligand is CHEMBL3645179. Check out the elaboration below.
| Comp2 (Given Ligand) | CHEMBL3645179 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1C#CC2CCCCC2 | CCN(c1cc2nn(-c3ccc(Nc4ccc(F)cc4)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00000200 810a0800 00000900 00090200 00402000 0000c000 00200200 00000000 00000100 00000840 00000080 40008808 00008000 00201000 01000000 40080008 00000200 02000000 02002002 00000001 00000008 08820a20 00000801 02400015 00000004 80010000 00000000 00000000 00000000 00020200 c0020800 00000000 | 00004006 00805e08 20180902 43390e00 010c0000 00004052 02040010 0200140c 00102900 000908c0 09312024 40118800 80008c23 01401201 800a0040 000e200c 04268000 02000004 0860000a 00224201 c0100101 1c878e38 20800800 8360001c 02104080 c0000040 02270080 8000108d 0c488104 0046804b c4048080 a01147e0 |