On Target NS5B_HCV1B 0.20353982/CHEMBL3645179
For the given ligand Comp3, we have found in our database that, being scored 0.20353982, the most similar ligand is CHEMBL3645179. Check out the elaboration below.
| Comp3 (Given Ligand) | CHEMBL3645179 (Similar Ligand) |
|---|---|
| O=C(O)c1cc(F)ccc1C#C/C\2=C/C/C=C2 | CCN(c1cc2nn(-c3ccc(Nc4ccc(F)cc4)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 08000200 800e0800 00100900 02090200 00402000 0000c011 00000200 00000502 00000100 00102840 01000000 d4008808 80008800 00201000 01000200 40080008 00000000 22008000 00000002 20100000 02001001 08820a20 0000a001 82400815 00000004 80010002 00400000 02c00001 00000002 00028000 c4000800 00000200 | 00004006 00805e08 20180902 43390e00 010c0000 00004052 02040010 0200140c 00102900 000908c0 09312024 40118800 80008c23 01401201 800a0040 000e200c 04268000 02000004 0860000a 00224201 c0100101 1c878e38 20800800 8360001c 02104080 c0000040 02270080 8000108d 0c488104 0046804b c4048080 a01147e0 |