On Target NA_INFB 0.15384616/CHEMBL113191
For the given ligand Comp2, we have found in our database that, being scored 0.15384616, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| Comp2 (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1C#CC2CCCCC2 | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 00000200 810a0800 00000900 00090200 00402000 0000c000 00200200 00000000 00000100 00000840 00000080 40008808 00008000 00201000 01000000 40080008 00000200 02000000 02002002 00000001 00000008 08820a20 00000801 02400015 00000004 80010000 00000000 00000000 00000000 00020200 c0020800 00000000 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |