On Target RDRP_SARS2 0.1015873/CHEMBL4065616
For the given ligand Comp3, we have found in our database that, being scored 0.1015873, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| Comp3 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| O=C(O)c1cc(F)ccc1C#C/C\2=C/C/C=C2 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 08000200 800e0800 00100900 02090200 00402000 0000c011 00000200 00000502 00000100 00102840 01000000 d4008808 80008800 00201000 01000200 40080008 00000000 22008000 00000002 20100000 02001001 08820a20 0000a001 82400815 00000004 80010002 00400000 02c00001 00000002 00028000 c4000800 00000200 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |