On Target NP_HCoV-OC43 0.10071942/CHEMBL3233481
For the given ligand Comp3, we have found in our database that, being scored 0.10071942, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Comp3 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=C(O)c1cc(F)ccc1C#C/C\2=C/C/C=C2 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 08000200 800e0800 00100900 02090200 00402000 0000c011 00000200 00000502 00000100 00102840 01000000 d4008808 80008800 00201000 01000200 40080008 00000000 22008000 00000002 20100000 02001001 08820a20 0000a001 82400815 00000004 80010002 00400000 02c00001 00000002 00028000 c4000800 00000200 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |