On Target ACE2_HUMAN 0.23529412/CHEMBL251809
For the given ligand Comp1, we have found in our database that, being scored 0.23529412, the most similar ligand is CHEMBL251809. Check out the elaboration below.
| Comp1 (Given Ligand) | CHEMBL251809 (Similar Ligand) |
|---|---|
| FC3c1ccccc1CC(c2ccccc2)C(F)C3F | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(OCc2ccc(C(F)(F)F)cc2)cc1)C(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00100102 00010200 00000400 00000022 00000400 00000001 00000800 40080850 08100000 40008000 20000000 01200000 00000020 00000200 01040000 02000000 00003000 00000001 04000100 08100000 00404000 20d00010 00000000 80000001 00000120 10000000 00000002 02020006 00120000 00000700 | 04010000 01005008 20100108 00150600 00001080 00004000 82040400 20000004 00000980 020a08d0 08300000 4001b000 06808002 01050000 81080001 02080008 10000000 02000000 00400008 00020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00120100 90000040 04000200 00060003 60104000 03012600 |