On Target NS5B_HCV1A 0.22834645/CHEMBL446360
For the given ligand Comp1, we have found in our database that, being scored 0.22834645, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| Comp1 (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| FC3c1ccccc1CC(c2ccccc2)C(F)C3F | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00100102 00010200 00000400 00000022 00000400 00000001 00000800 40080850 08100000 40008000 20000000 01200000 00000020 00000200 01040000 02000000 00003000 00000001 04000100 08100000 00404000 20d00010 00000000 80000001 00000120 10000000 00000002 02020006 00120000 00000700 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |