On Target RDRP_SARS2 0.112676054/CHEMBL4065616
For the given ligand Comp1, we have found in our database that, being scored 0.112676054, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| Comp1 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| FC3c1ccccc1CC(c2ccccc2)C(F)C3F | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00000000 01000000 00100102 00010200 00000400 00000022 00000400 00000001 00000800 40080850 08100000 40008000 20000000 01200000 00000020 00000200 01040000 02000000 00003000 00000001 04000100 08100000 00404000 20d00010 00000000 80000001 00000120 10000000 00000002 02020006 00120000 00000700 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |