On Target NA_A-H3N8 0.15204678/CHEMBL4285767
For the given ligand Comp1, we have found in our database that, being scored 0.15204678, the most similar ligand is CHEMBL4285767. Check out the elaboration below.
| Comp1 (Given Ligand) | CHEMBL4285767 (Similar Ligand) |
|---|---|
| FC3c1ccccc1CC(c2ccccc2)C(F)C3F | CCc1ccc(CN[C@H]2CC(C(=O)O)=C[C@@H](OC(CC)CC)[C@@H]2NC(C)=O)cc1 |
|
|
|
|
|
|
| 00000000 01000000 00100102 00010200 00000400 00000022 00000400 00000001 00000800 40080850 08100000 40008000 20000000 01200000 00000020 00000200 01040000 02000000 00003000 00000001 04000100 08100000 00404000 20d00010 00000000 80000001 00000120 10000000 00000002 02020006 00120000 00000700 | 00070040 09007000 00100100 84010700 00180080 00000800 02080180 3a00140a 11000100 001908c8 48200000 41019801 8402881a 01882000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000020 38048e80 13008080 02500018 10001401 c0001400 00c04000 90000001 0c000300 00060403 24060000 00800e10 |