On Target PLP_SARS 0.14473684/CHEMBL212218
For the given ligand Comp1, we have found in our database that, being scored 0.14473684, the most similar ligand is CHEMBL212218. Check out the elaboration below.
| Comp1 (Given Ligand) | CHEMBL212218 (Similar Ligand) |
|---|---|
| FC3c1ccccc1CC(c2ccccc2)C(F)C3F | Cc1cc(S(=O)(=O)c2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])c(Cl)cc1Cl |
|
|
|
|
|
|
| 00000000 01000000 00100102 00010200 00000400 00000022 00000400 00000001 00000800 40080850 08100000 40008000 20000000 01200000 00000020 00000200 01040000 02000000 00003000 00000001 04000100 08100000 00404000 20d00010 00000000 80000001 00000120 10000000 00000002 02020006 00120000 00000700 | 00008002 00c01210 00120100 00910200 00040100 08010020 00000400 10000000 14000000 00004870 04002004 60008804 02010005 01010400 a03001c0 00000010 04041100 02004000 00200000 00002140 c0022004 0c604100 20800820 08480c09 000c6000 c0080200 10244010 b0006020 00c00200 01060200 00120000 04030220 |