On Target E1_HCV77 0.2596154/CHEMBL4107728
For the given ligand Comp1, we have found in our database that, being scored 0.2596154, the most similar ligand is CHEMBL4107728. Check out the elaboration below.
| Comp1 (Given Ligand) | CHEMBL4107728 (Similar Ligand) |
|---|---|
| FC3c1ccccc1CC(c2ccccc2)C(F)C3F | CC[C@@H](N)c1ccc(C)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00000000 01000000 00100102 00010200 00000400 00000022 00000400 00000001 00000800 40080850 08100000 40008000 20000000 01200000 00000020 00000200 01040000 02000000 00003000 00000001 04000100 08100000 00404000 20d00010 00000000 80000001 00000120 10000000 00000002 02020006 00120000 00000700 | 00000040 00000800 00100100 02010600 00000201 00008010 00000400 01001000 00000900 00082e40 08100000 50008a00 80008840 00201000 00000000 08080008 03000200 02000000 00000400 00000001 00000100 18028200 01004000 10400014 00000000 a0000000 08000000 40800001 02000080 00068002 80040000 00000600 |