On Target ACE2_HUMAN 0.15789473/CHEMBL258333
For the given ligand molecule_mod, we have found in our database that, being scored 0.15789473, the most similar ligand is CHEMBL258333. Check out the elaboration below.
| molecule_mod (Given Ligand) | CHEMBL258333 (Similar Ligand) |
|---|---|
| Cc1ccccc1 | O=C(CS)N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00000000 02000000 00000000 00000000 00000000 08000000 00000000 00400000 00000000 80000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00002000 00005000 00100100 00110600 00000080 00000000 80000000 00000004 00000980 020a0840 08300000 4000b800 06008002 00040000 00000000 00080008 10020000 02000000 04400008 10000201 00000100 18200e00 13000040 85400018 00000800 80000000 00000000 00000040 04004000 00060003 20004000 02010600 |