On Target NA_INFB 0.10084034/CHEMBL113191
For the given ligand molecule_mod, we have found in our database that, being scored 0.10084034, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| molecule_mod (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| Cc1ccccc1 | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00000000 02000000 00000000 00000000 00000000 08000000 00000000 00400000 00000000 80000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |