On Target CAPSD_HCV77 0.1764706/CHEMBL4110799
For the given ligand molecule_mod, we have found in our database that, being scored 0.1764706, the most similar ligand is CHEMBL4110799. Check out the elaboration below.
| molecule_mod (Given Ligand) | CHEMBL4110799 (Similar Ligand) |
|---|---|
| Cc1ccccc1 | CC[C@@H](N)c1ccc(F)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00000000 02000000 00000000 00000000 00000000 08000000 00000000 00400000 00000000 80000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00000040 00000800 00100100 02010600 00000201 00000010 00000000 01001000 00000800 00090e40 08100000 c0008200 00008840 00001000 00000000 08080008 03000200 02000180 00000400 00100001 00000100 18028200 01000000 10400014 00000000 a0000000 08000000 40800001 00000080 00068002 80040000 00000600 |