On Target GP_EBOV 0.25714287/CHEMBL1655
For the given ligand aspirin, we have found in our database that, being scored 0.25714287, the most similar ligand is CHEMBL1655. Check out the elaboration below.
| aspirin (Given Ligand) | CHEMBL1655 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CN(C)CCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04022000 00000008 20000308 00010602 00001080 00000000 82040080 01008400 00000800 00180840 08300500 40018000 00800002 00000000 01001003 00080008 00000400 02000000 00000000 00020001 00000100 18040100 12008081 00400010 01000000 a8000000 00522000 40000008 00400280 00060002 04000000 00820600 |