On Target NA_A-H3N8 0.18181819/CHEMBL4292576
For the given ligand aspirin, we have found in our database that, being scored 0.18181819, the most similar ligand is CHEMBL4292576. Check out the elaboration below.
| aspirin (Given Ligand) | CHEMBL4292576 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(OC)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 00070040 09007008 20100108 84010700 00181080 00000800 020c0180 3a00140a 11000000 001108c8 40200000 41019001 0402881a 01882000 01001409 00081008 10a04000 02000060 60c12010 00020201 00000020 38048e80 13008080 02500018 10001401 c0001400 00e24000 90000001 0c000300 00060401 24060000 00800a10 |