On Target NS5B_HCV1A 0.3962264/CHEMBL446360
For the given ligand 3b, we have found in our database that, being scored 0.3962264, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| 3b (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| CC(C)C(=O)c1c(O)cc(O)c(C(=O)C(C)C)c1O | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 00000001 00000808 20000101 00010200 00000001 00020000 02800000 00000200 00000800 00080a40 08100000 40009040 00008002 00000000 00000000 08082008 00000000 02000000 00000000 00020801 00000100 08020200 01000000 00400014 00000000 80000000 00120000 00800000 00000000 00020002 80000000 00000400 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |