On Target PR_HIV1 0.17105263/CHEMBL492666
For the given ligand 2a, we have found in our database that, being scored 0.17105263, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| 2a (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| CC(=O)c1c(O)cc(O)cc1O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00000001 00000808 20000101 00010200 00000000 00020000 02000000 00000200 00000000 00080840 08000000 40008000 00008002 00000000 00000000 00002008 00000000 02000000 00000000 00020800 00000000 08020200 00000000 00400014 00000000 80000000 00120000 00000000 00000000 00020002 80000000 00000400 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |