On Target PR_SARS 0.21875/CHEMBL471187
For the given ligand mb, we have found in our database that, being scored 0.21875, the most similar ligand is CHEMBL471187. Check out the elaboration below.
| mb (Given Ligand) | CHEMBL471187 (Similar Ligand) |
|---|---|
| CC(=O)c1c(O)cc(O)c(C(C)=O)c1O | Oc1cc(O)cc(Oc2c(O)cc(O)c3c2Oc2c(O)cc(O)cc2O3)c1 |
|
|
|
|
|
|
| 00000001 00000808 20000101 00010200 00000001 00020000 02800000 00000200 00000000 00080a40 08000000 40008000 00008002 00000000 00000000 08082008 00000000 02000000 00000000 00020800 00000000 08020200 00000000 00400014 00000000 80000000 00120000 00800000 00000000 00020002 80000000 00000400 | 00000001 00000008 20000008 00000200 00001000 00000000 42000000 00000000 00100000 00000840 00000000 00008800 00004002 00000000 01000001 00008008 00000000 00000004 00002000 00020800 00400000 08000100 00000000 00000000 00000000 20000000 00080000 00200000 80000200 00020008 00000400 02000000 |