On Target PLP_SARS 0.22222222/CHEMBL222735
For the given ligand ma, we have found in our database that, being scored 0.22222222, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| ma (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| CC(=O)c1c(O)cc(O)cc1O | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 00000001 00000808 20000101 00010200 00000000 00020000 02000000 00000200 00000000 00080840 08000000 40008000 00008002 00000000 00000000 00002008 00000000 02000000 00000000 00020800 00000000 08020200 00000000 00400014 00000000 80000000 00120000 00000000 00000000 00020002 80000000 00000400 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |