On Target NS5B_HCV1A 0.31304348/CHEMBL446360
For the given ligand Aspirin, we have found in our database that, being scored 0.31304348, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |