On Target PLP_SARS 0.40952381/CHEMBL222735
For the given ligand Aspirin, we have found in our database that, being scored 0.40952381, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |