On Target PR_FCoV 0.25728154/CHEMBL4214471
For the given ligand Galidesivir, we have found in our database that, being scored 0.25728154, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| Galidesivir (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| Nc2ncnc3c(C1NC(CO)C(O)C1O)c[nH]c23 | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 1000000a 0180c800 00100102 c8880630 002c01c0 0000c010 0000e000 02001800 00500900 000800c0 61300004 40011000 08000802 01a00800 002c0440 000c000c 18020008 02000004 01e02400 40200201 40000100 18008860 278000c0 00400010 00046001 c0000000 08008080 80000004 0040010a 00460002 60008200 800006e0 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |