On Target NS3_HCV1B 0.27237353/CHEMBL3954962
For the given ligand Galidesivir triphosphate form, we have found in our database that, being scored 0.27237353, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| Galidesivir triphosphate form (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| Nc2ncnc3c(C1NC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O)c[nH]c23 | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 1000080a 0180c800 20500502 c8880e30 002c01c4 0012c030 0080e000 02001880 00500900 000800c0 61300004 48011000 08000802 01a20820 002e0440 000c060c 190e00a8 02000006 01e02400 40203203 40000100 1c008860 278000c0 00400010 40046001 c0000100 0a008080 80050004 0040010a 00460016 61408280 c000a6e2 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |