On Target DPM_HHV1K 0.2777778/CHEMBL481172
For the given ligand Galidesivir, we have found in our database that, being scored 0.2777778, the most similar ligand is CHEMBL481172. Check out the elaboration below.
| Galidesivir (Given Ligand) | CHEMBL481172 (Similar Ligand) |
|---|---|
| Nc2ncnc3c(C1NC(CO)C(O)C1O)c[nH]c23 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccco1 |
|
|
|
|
|
|
| 1000000a 0180c800 00100102 c8880630 002c01c0 0000c010 0000e000 02001800 00500900 000800c0 61300004 40011000 08000802 01a00800 002c0440 000c000c 18020008 02000004 01e02400 40200201 40000100 18008860 278000c0 00400010 00046001 c0000000 08008080 80000004 0040010a 00460002 60008200 800006e0 | 1041818a 00a2d800 80184101 00014610 04041683 80004000 00004400 4a281200 020841e1 800808d0 01200434 4001b802 c6089c6e 01600188 00004460 000c040c 10026000 c200c004 02200080 08000200 c0000000 1a268f10 22a04000 a159001c 30842070 e0000402 0c940054 98040000 24402101 03860043 e0140000 80020600 |