On Target DPM_HHV1K 0.25084746/CHEMBL479371
For the given ligand Galidesivir triphosphate form, we have found in our database that, being scored 0.25084746, the most similar ligand is CHEMBL479371. Check out the elaboration below.
| Galidesivir triphosphate form (Given Ligand) | CHEMBL479371 (Similar Ligand) |
|---|---|
| Nc2ncnc3c(C1NC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O)c[nH]c23 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccccn1 |
|
|
|
|
|
|
| 1000080a 0180c800 20500502 c8880e30 002c01c4 0012c030 0080e000 02001880 00500900 000800c0 61300004 48011000 08000802 01a20820 002e0440 000c060c 190e00a8 02000006 01e02400 40203203 40000100 1c008860 278000c0 00400010 40046001 c0000100 0a008080 80050004 0040010a 00460016 61408280 c000a6e2 | 1401818a 00a2d800 00184120 10014610 040416a3 80004000 00004400 42281200 020843e1 80080ad0 09208434 4081b802 c6009c6e 01600188 01020460 020c040c 1002e000 ca804004 02200080 08000200 c0000000 1a268f30 22a04002 a158001c 10843020 e0000002 0c940054 98040000 04402104 03860043 e0140000 a0020600 |