On Target RDRP_SARS2 0.29/CHEMBL4065616
For the given ligand Galidesivir, we have found in our database that, being scored 0.29, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| Galidesivir (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| Nc2ncnc3c(C1NC(CO)C(O)C1O)c[nH]c23 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 1000000a 0180c800 00100102 c8880630 002c01c0 0000c010 0000e000 02001800 00500900 000800c0 61300004 40011000 08000802 01a00800 002c0440 000c000c 18020008 02000004 01e02400 40200201 40000100 18008860 278000c0 00400010 00046001 c0000000 08008080 80000004 0040010a 00460002 60008200 800006e0 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |